C9H16S — CID 574946
3,4,4a,5,6,7,8,8a-octahydro-2H-thiochromene (PubChem CID 574946) has the molecular formula C9H16S and a molecular weight of 156.29 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-thiochromene.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-thiochromene |
|---|---|
| PubChem CID | 574946 |
| Molecular Formula | C9H16S |
| Molecular Weight | 156.29 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-thiochromene |
| SMILES | C1CCC2SCCCC2C1 |
| InChI | InChI=1S/C9H16S/c1-2-6-9-8(4-1)5-3-7-10-9/h8-9H,1-7H2 |
| InChIKey | ILOILTHGYLSHSI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |