About 3-[5-(4-cyclopropyl-1,4-diazepane-1-carbonyl)pyrazin-2-yl]oxybenzonitrile
3-[5-(4-cyclopropyl-1,4-diazepane-1-carbonyl)pyrazin-2-yl]oxybenzonitrile (PubChem CID 57494689) has the molecular formula C20H21N5O2
and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-[5-(4-cyclopropyl-1,4-diazepane-1-carbonyl)pyrazin-2-yl]oxybenzonitrile.
Molecular Properties
| Compound Name | 3-[5-(4-cyclopropyl-1,4-diazepane-1-carbonyl)pyrazin-2-yl]oxybenzonitrile |
| PubChem CID | 57494689 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 3-[5-(4-cyclopropyl-1,4-diazepane-1-carbonyl)pyrazin-2-yl]oxybenzonitrile |
| SMILES | N#Cc1cccc(Oc2cnc(C(=O)N3CCCN(C4CC4)CC3)cn2)c1 |
| InChI | InChI=1S/C20H21N5O2/c21-12-15-3-1-4-17(11-15)27-19-14-22-18(13-23-19)20(26)25-8-2-7-24(9-10-25)16-5-6-16/h1,3-4,11,13-14,16H,2,5-10H2 |
| InChIKey | LRVDKTNZNBOJCW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[5-(4-cyclopropyl-1,4-diazepane-1-carbonyl)pyrazin-2-yl]oxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(4-cyclopropyl-1,4-diazepane-1-carbonyl)pyrazin-2-yl]oxybenzonitrile?
The IUPAC name of 3-[5-(4-cyclopropyl-1,4-diazepane-1-carbonyl)pyrazin-2-yl]oxybenzonitrile (CID 57494689) is 3-[5-(4-cyclopropyl-1,4-diazepane-1-carbonyl)pyrazin-2-yl]oxybenzonitrile.
What is the SMILES notation for 3-[5-(4-cyclopropyl-1,4-diazepane-1-carbonyl)pyrazin-2-yl]oxybenzonitrile?
The canonical SMILES for 3-[5-(4-cyclopropyl-1,4-diazepane-1-carbonyl)pyrazin-2-yl]oxybenzonitrile is N#Cc1cccc(Oc2cnc(C(=O)N3CCCN(C4CC4)CC3)cn2)c1.
What is the InChIKey of 3-[5-(4-cyclopropyl-1,4-diazepane-1-carbonyl)pyrazin-2-yl]oxybenzonitrile?
The InChIKey is LRVDKTNZNBOJCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N5O2/c21-12-15-3-1-4-17(11-15)27-19-14-22-18(13-23-19)20(26)25-8-2-7-24(9-10-25)16-5-6-16/h1,3-4,11,13-14,16H,2,5-10H2.
What are the key properties of 3-[5-(4-cyclopropyl-1,4-diazepane-1-carbonyl)pyrazin-2-yl]oxybenzonitrile?
3-[5-(4-cyclopropyl-1,4-diazepane-1-carbonyl)pyrazin-2-yl]oxybenzonitrile has a molecular weight of 363.42 g/mol, XLogP of 2.45, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(4-cyclopropyl-1,4-diazepane-1-carbonyl)pyrazin-2-yl]oxybenzonitrile is sourced from PubChem (CID 57494689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).