C15H10O10 — CID 57494717
5,6,7,8-tetrahydroxy-2-(2,3,4,5-tetrahydroxyphenyl)chromen-4-one (PubChem CID 57494717) has the molecular formula C15H10O10 and a molecular weight of 350.24 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroxy-2-(2,3,4,5-tetrahydroxyphenyl)chromen-4-one.
| Compound Name | 5,6,7,8-tetrahydroxy-2-(2,3,4,5-tetrahydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 57494717 |
| Molecular Formula | C15H10O10 |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 5,6,7,8-tetrahydroxy-2-(2,3,4,5-tetrahydroxyphenyl)chromen-4-one |
| SMILES | O=c1cc(-c2cc(O)c(O)c(O)c2O)oc2c(O)c(O)c(O)c(O)c12 |
| InChI | InChI=1S/C15H10O10/c16-4-2-6(3-1-5(17)9(19)11(21)8(3)18)25-15-7(4)10(20)12(22)13(23)14(15)24/h1-2,17-24H |
| InChIKey | WGGUJYPQPMLINK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 192.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|