C21H25F2N3O2 — CID 57495599
4-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2-oxoimidazolidin-1-yl]adamantane-1-carboxamide (PubChem CID 57495599) has the molecular formula C21H25F2N3O2 and a molecular weight of 389.45 g/mol. Its IUPAC name is 4-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2-oxoimidazolidin-1-yl]adamantane-1-carboxamide.
| Compound Name | 4-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2-oxoimidazolidin-1-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 57495599 |
| Molecular Formula | C21H25F2N3O2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 4-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2-oxoimidazolidin-1-yl]adamantane-1-carboxamide |
| SMILES | C[C@@]1(c2ccc(F)c(F)c2)CN(C2C3CC4CC2CC(C(N)=O)(C4)C3)C(=O)N1 |
| InChI | InChI=1S/C21H25F2N3O2/c1-20(14-2-3-15(22)16(23)6-14)10-26(19(28)25-20)17-12-4-11-5-13(17)9-21(7-11,8-12)18(24)27/h2-3,6,11-13,17H,4-5,7-10H2,1H3,(H2,24,27)(H,25,28)/t11?,12?,13?,17?,20-,21?/m0/s1 |
| InChIKey | GMJSAANNZXMROB-KOORWYFBSA-N |
| XLogP | 2.89 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |