C13H18 — CID 57495738
5-ethyl-1-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 57495738) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 5-ethyl-1-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-ethyl-1-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 57495738 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 5-ethyl-1-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCc1cccc2c1CCCC2C |
| InChI | InChI=1S/C13H18/c1-3-11-7-5-8-12-10(2)6-4-9-13(11)12/h5,7-8,10H,3-4,6,9H2,1-2H3 |
| InChIKey | RUMBJDPBRMOOBB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |