About (5R)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine
(5R)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine (PubChem CID 57495971) has the molecular formula C11H15N3O
and a molecular weight of 205.26 g/mol. Its IUPAC name is (5R)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine.
Molecular Properties
| Compound Name | (5R)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine |
| PubChem CID | 57495971 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | (5R)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine |
| SMILES | C[C@@]1(c2cccc(N)c2)COCC(N)=N1 |
| InChI | InChI=1S/C11H15N3O/c1-11(7-15-6-10(13)14-11)8-3-2-4-9(12)5-8/h2-5H,6-7,12H2,1H3,(H2,13,14)/t11-/m0/s1 |
| InChIKey | IWNXZZUSJQOSBO-NSHDSACASA-N |
| XLogP | 0.87 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine?
The IUPAC name of (5R)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine (CID 57495971) is (5R)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine.
What is the SMILES notation for (5R)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine?
The canonical SMILES for (5R)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine is C[C@@]1(c2cccc(N)c2)COCC(N)=N1.
What is the InChIKey of (5R)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine?
The InChIKey is IWNXZZUSJQOSBO-NSHDSACASA-N. The full InChI is InChI=1S/C11H15N3O/c1-11(7-15-6-10(13)14-11)8-3-2-4-9(12)5-8/h2-5H,6-7,12H2,1H3,(H2,13,14)/t11-/m0/s1.
What are the key properties of (5R)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine?
(5R)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine has a molecular weight of 205.26 g/mol, XLogP of 0.87, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(3-aminophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine is sourced from PubChem (CID 57495971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).