C15H20N4O2 — CID 57496605
3-[(4R)-2-amino-1,4,5,5-tetramethyl-6-oxopyrimidin-4-yl]benzamide (PubChem CID 57496605) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-[(4R)-2-amino-1,4,5,5-tetramethyl-6-oxopyrimidin-4-yl]benzamide.
| Compound Name | 3-[(4R)-2-amino-1,4,5,5-tetramethyl-6-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 57496605 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 3-[(4R)-2-amino-1,4,5,5-tetramethyl-6-oxopyrimidin-4-yl]benzamide |
| SMILES | CN1C(=O)C(C)(C)[C@@](C)(c2cccc(C(N)=O)c2)N=C1N |
| InChI | InChI=1S/C15H20N4O2/c1-14(2)12(21)19(4)13(17)18-15(14,3)10-7-5-6-9(8-10)11(16)20/h5-8H,1-4H3,(H2,16,20)(H2,17,18)/t15-/m1/s1 |
| InChIKey | CDIGVESIKLWSTL-OAHLLOKOSA-N |
| XLogP | 0.81 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |