C21H31FN4O2 — CID 57497001
(6S)-2-amino-6-[5-[[(2S,6R)-2,6-dimethyloxan-4-yl]amino]-2-fluorophenyl]-3,5,5,6-tetramethylpyrimidin-4-one (PubChem CID 57497001) has the molecular formula C21H31FN4O2 and a molecular weight of 390.50 g/mol. Its IUPAC name is (6S)-2-amino-6-[5-[[(2S,6R)-2,6-dimethyloxan-4-yl]amino]-2-fluorophenyl]-3,5,5,6-tetramethylpyrimidin-4-one.
| Compound Name | (6S)-2-amino-6-[5-[[(2S,6R)-2,6-dimethyloxan-4-yl]amino]-2-fluorophenyl]-3,5,5,6-tetramethylpyrimidin-4-one |
|---|---|
| PubChem CID | 57497001 |
| Molecular Formula | C21H31FN4O2 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (6S)-2-amino-6-[5-[[(2S,6R)-2,6-dimethyloxan-4-yl]amino]-2-fluorophenyl]-3,5,5,6-tetramethylpyrimidin-4-one |
| SMILES | C[C@@H]1CC(Nc2ccc(F)c([C@@]3(C)N=C(N)N(C)C(=O)C3(C)C)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C21H31FN4O2/c1-12-9-15(10-13(2)28-12)24-14-7-8-17(22)16(11-14)21(5)20(3,4)18(27)26(6)19(23)25-21/h7-8,11-13,15,24H,9-10H2,1-6H3,(H2,23,25)/t12-,13+,15?,21-/m1/s1 |
| InChIKey | AOBNHMPCEJNSOD-NFSWRRQISA-N |
| XLogP | 3.22 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |