C11H10IN3O — CID 57497689
azetidin-1-yl-(3-iodoimidazo[1,2-a]pyridin-7-yl)methanone (PubChem CID 57497689) has the molecular formula C11H10IN3O and a molecular weight of 327.12 g/mol. Its IUPAC name is azetidin-1-yl-(3-iodoimidazo[1,2-a]pyridin-7-yl)methanone.
| Compound Name | azetidin-1-yl-(3-iodoimidazo[1,2-a]pyridin-7-yl)methanone |
|---|---|
| PubChem CID | 57497689 |
| Molecular Formula | C11H10IN3O |
| Molecular Weight | 327.12 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | azetidin-1-yl-(3-iodoimidazo[1,2-a]pyridin-7-yl)methanone |
| SMILES | O=C(c1ccn2c(I)cnc2c1)N1CCC1 |
| InChI | InChI=1S/C11H10IN3O/c12-9-7-13-10-6-8(2-5-15(9)10)11(16)14-3-1-4-14/h2,5-7H,1,3-4H2 |
| InChIKey | IHOPZAQFGAOPKF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.12 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|