About 2-hexyliminobutanoic acid
2-hexyliminobutanoic acid (PubChem CID 575036) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-hexyliminobutanoic acid.
Molecular Properties
| Compound Name | 2-hexyliminobutanoic acid |
| PubChem CID | 575036 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 2-hexyliminobutanoic acid |
| SMILES | CCCCCC/N=C(\CC)C(=O)O |
| InChI | InChI=1S/C10H19NO2/c1-3-5-6-7-8-11-9(4-2)10(12)13/h3-8H2,1-2H3,(H,12,13)/b11-9+ |
| InChIKey | DHPOIFBOZJVHRR-PKNBQFBNSA-N |
| XLogP | 2.50 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyliminobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyliminobutanoic acid?
The IUPAC name of 2-hexyliminobutanoic acid (CID 575036) is 2-hexyliminobutanoic acid.
What is the SMILES notation for 2-hexyliminobutanoic acid?
The canonical SMILES for 2-hexyliminobutanoic acid is CCCCCC/N=C(\CC)C(=O)O.
What is the InChIKey of 2-hexyliminobutanoic acid?
The InChIKey is DHPOIFBOZJVHRR-PKNBQFBNSA-N. The full InChI is InChI=1S/C10H19NO2/c1-3-5-6-7-8-11-9(4-2)10(12)13/h3-8H2,1-2H3,(H,12,13)/b11-9+.
What are the key properties of 2-hexyliminobutanoic acid?
2-hexyliminobutanoic acid has a molecular weight of 185.27 g/mol, XLogP of 2.50, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyliminobutanoic acid is sourced from PubChem (CID 575036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).