About ethyl 4-aminopent-2-enoate
ethyl 4-aminopent-2-enoate (PubChem CID 575042) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is ethyl 4-aminopent-2-enoate.
Molecular Properties
| Compound Name | ethyl 4-aminopent-2-enoate |
| PubChem CID | 575042 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | ethyl 4-aminopent-2-enoate |
| SMILES | CCOC(=O)C=CC(C)N |
| InChI | InChI=1S/C7H13NO2/c1-3-10-7(9)5-4-6(2)8/h4-6H,3,8H2,1-2H3 |
| InChIKey | LVQXQSJXFIEHAZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-aminopent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-aminopent-2-enoate?
The IUPAC name of ethyl 4-aminopent-2-enoate (CID 575042) is ethyl 4-aminopent-2-enoate.
What is the SMILES notation for ethyl 4-aminopent-2-enoate?
The canonical SMILES for ethyl 4-aminopent-2-enoate is CCOC(=O)C=CC(C)N.
What is the InChIKey of ethyl 4-aminopent-2-enoate?
The InChIKey is LVQXQSJXFIEHAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-3-10-7(9)5-4-6(2)8/h4-6H,3,8H2,1-2H3.
What are the key properties of ethyl 4-aminopent-2-enoate?
ethyl 4-aminopent-2-enoate has a molecular weight of 143.19 g/mol, XLogP of 0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-aminopent-2-enoate is sourced from PubChem (CID 575042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).