About 2,3,6-trimethyl-1,3-oxazinane
2,3,6-trimethyl-1,3-oxazinane (PubChem CID 575121) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is 2,3,6-trimethyl-1,3-oxazinane.
Molecular Properties
| Compound Name | 2,3,6-trimethyl-1,3-oxazinane |
| PubChem CID | 575121 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 2,3,6-trimethyl-1,3-oxazinane |
| SMILES | CC1CCN(C)C(C)O1 |
| InChI | InChI=1S/C7H15NO/c1-6-4-5-8(3)7(2)9-6/h6-7H,4-5H2,1-3H3 |
| InChIKey | FOUCKPOQIHJBLQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3,6-trimethyl-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,6-trimethyl-1,3-oxazinane?
The IUPAC name of 2,3,6-trimethyl-1,3-oxazinane (CID 575121) is 2,3,6-trimethyl-1,3-oxazinane.
What is the SMILES notation for 2,3,6-trimethyl-1,3-oxazinane?
The canonical SMILES for 2,3,6-trimethyl-1,3-oxazinane is CC1CCN(C)C(C)O1.
What is the InChIKey of 2,3,6-trimethyl-1,3-oxazinane?
The InChIKey is FOUCKPOQIHJBLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO/c1-6-4-5-8(3)7(2)9-6/h6-7H,4-5H2,1-3H3.
What are the key properties of 2,3,6-trimethyl-1,3-oxazinane?
2,3,6-trimethyl-1,3-oxazinane has a molecular weight of 129.20 g/mol, XLogP of 1.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6-trimethyl-1,3-oxazinane is sourced from PubChem (CID 575121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).