C11H24N2O2Si2 — CID 575142
5,5-dimethyl-1,3-bis(trimethylsilyl)imidazolidine-2,4-dione (PubChem CID 575142) has the molecular formula C11H24N2O2Si2 and a molecular weight of 272.50 g/mol. Its IUPAC name is 5,5-dimethyl-1,3-bis(trimethylsilyl)imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-1,3-bis(trimethylsilyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 575142 |
| Molecular Formula | C11H24N2O2Si2 |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 5,5-dimethyl-1,3-bis(trimethylsilyl)imidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C |
| InChI | InChI=1S/C11H24N2O2Si2/c1-11(2)9(14)12(16(3,4)5)10(15)13(11)17(6,7)8/h1-8H3 |
| InChIKey | HVLDAPARQYMXFQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|