C16H24O10 — CID 575175
8,9,17,18-tetramethyl-1,4,7,10,13,16-hexaoxacyclooctadecane-2,6,11,15-tetrone (PubChem CID 575175) has the molecular formula C16H24O10 and a molecular weight of 376.36 g/mol. Its IUPAC name is 8,9,17,18-tetramethyl-1,4,7,10,13,16-hexaoxacyclooctadecane-2,6,11,15-tetrone.
| Compound Name | 8,9,17,18-tetramethyl-1,4,7,10,13,16-hexaoxacyclooctadecane-2,6,11,15-tetrone |
|---|---|
| PubChem CID | 575175 |
| Molecular Formula | C16H24O10 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 8,9,17,18-tetramethyl-1,4,7,10,13,16-hexaoxacyclooctadecane-2,6,11,15-tetrone |
| SMILES | CC1OC(=O)COCC(=O)OC(C)C(C)OC(=O)COCC(=O)OC1C |
| InChI | InChI=1S/C16H24O10/c1-9-10(2)24-14(18)6-22-8-16(20)26-12(4)11(3)25-15(19)7-21-5-13(17)23-9/h9-12H,5-8H2,1-4H3 |
| InChIKey | NWIJZPMSGAHNMY-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|