About 1,1-dimethylsilocan-5-one
1,1-dimethylsilocan-5-one (PubChem CID 575201) has the molecular formula C9H18OSi
and a molecular weight of 170.33 g/mol. Its IUPAC name is 1,1-dimethylsilocan-5-one.
Molecular Properties
| Compound Name | 1,1-dimethylsilocan-5-one |
| PubChem CID | 575201 |
| Molecular Formula | C9H18OSi |
| Molecular Weight | 170.33 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1,1-dimethylsilocan-5-one |
| SMILES | C[Si]1(C)CCCC(=O)CCC1 |
| InChI | InChI=1S/C9H18OSi/c1-11(2)7-3-5-9(10)6-4-8-11/h3-8H2,1-2H3 |
| InChIKey | IQRKKWHCGORCLF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethylsilocan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethylsilocan-5-one?
The IUPAC name of 1,1-dimethylsilocan-5-one (CID 575201) is 1,1-dimethylsilocan-5-one.
What is the SMILES notation for 1,1-dimethylsilocan-5-one?
The canonical SMILES for 1,1-dimethylsilocan-5-one is C[Si]1(C)CCCC(=O)CCC1.
What is the InChIKey of 1,1-dimethylsilocan-5-one?
The InChIKey is IQRKKWHCGORCLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18OSi/c1-11(2)7-3-5-9(10)6-4-8-11/h3-8H2,1-2H3.
What are the key properties of 1,1-dimethylsilocan-5-one?
1,1-dimethylsilocan-5-one has a molecular weight of 170.33 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethylsilocan-5-one is sourced from PubChem (CID 575201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).