C19H21ClN2O3S — CID 57524309
N-[1-[(2R)-2-(4-chlorophenyl)-1-hydroxybutan-2-yl]indol-4-yl]methanesulfonamide (PubChem CID 57524309) has the molecular formula C19H21ClN2O3S and a molecular weight of 392.90 g/mol. Its IUPAC name is N-[1-[(2R)-2-(4-chlorophenyl)-1-hydroxybutan-2-yl]indol-4-yl]methanesulfonamide.
| Compound Name | N-[1-[(2R)-2-(4-chlorophenyl)-1-hydroxybutan-2-yl]indol-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 57524309 |
| Molecular Formula | C19H21ClN2O3S |
| Molecular Weight | 392.90 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N-[1-[(2R)-2-(4-chlorophenyl)-1-hydroxybutan-2-yl]indol-4-yl]methanesulfonamide |
| SMILES | CC[C@](CO)(C1=CC=C(C=C1)Cl)N2C=CC3=C(C=CC=C32)NS(=O)(=O)C |
| InChI | InChI=1S/C19H21ClN2O3S/c1-3-19(13-23,14-7-9-15(20)10-8-14)22-12-11-16-17(21-26(2,24)25)5-4-6-18(16)22/h4-12,21,23H,3,13H2,1-2H3/t19-/m0/s1 |
| InChIKey | RKFFHZQKHIMLAH-IBGZPJMESA-N |
| XLogP | 3.30 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | 574 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.90 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |