About N,N-diethyloctadecanamide
N,N-diethyloctadecanamide (PubChem CID 575487) has the molecular formula C22H45NO
and a molecular weight of 339.61 g/mol. Its IUPAC name is N,N-diethyloctadecanamide.
Molecular Properties
| Compound Name | N,N-diethyloctadecanamide |
| PubChem CID | 575487 |
| Molecular Formula | C22H45NO |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 339.35 |
| IUPAC Name | N,N-diethyloctadecanamide |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)N(CC)CC |
| InChI | InChI=1S/C22H45NO/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(24)23(5-2)6-3/h4-21H2,1-3H3 |
| InChIKey | QPDIFNAJIOOAQI-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyloctadecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyloctadecanamide?
The IUPAC name of N,N-diethyloctadecanamide (CID 575487) is N,N-diethyloctadecanamide.
What is the SMILES notation for N,N-diethyloctadecanamide?
The canonical SMILES for N,N-diethyloctadecanamide is CCCCCCCCCCCCCCCCCC(=O)N(CC)CC.
What is the InChIKey of N,N-diethyloctadecanamide?
The InChIKey is QPDIFNAJIOOAQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H45NO/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(24)23(5-2)6-3/h4-21H2,1-3H3.
What are the key properties of N,N-diethyloctadecanamide?
N,N-diethyloctadecanamide has a molecular weight of 339.61 g/mol, XLogP of 7.12, 18 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyloctadecanamide is sourced from PubChem (CID 575487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).