About 3-propyl-1,2,4-thiadiazol-5-amine
3-propyl-1,2,4-thiadiazol-5-amine (PubChem CID 575489) has the molecular formula C5H9N3S
and a molecular weight of 143.22 g/mol. Its IUPAC name is 3-propyl-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | 3-propyl-1,2,4-thiadiazol-5-amine |
| PubChem CID | 575489 |
| Molecular Formula | C5H9N3S |
| Molecular Weight | 143.22 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 3-propyl-1,2,4-thiadiazol-5-amine |
| SMILES | CCCc1nsc(N)n1 |
| InChI | InChI=1S/C5H9N3S/c1-2-3-4-7-5(6)9-8-4/h2-3H2,1H3,(H2,6,7,8) |
| InChIKey | FFNJNXAQRQAKMW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-propyl-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-1,2,4-thiadiazol-5-amine?
The IUPAC name of 3-propyl-1,2,4-thiadiazol-5-amine (CID 575489) is 3-propyl-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for 3-propyl-1,2,4-thiadiazol-5-amine?
The canonical SMILES for 3-propyl-1,2,4-thiadiazol-5-amine is CCCc1nsc(N)n1.
What is the InChIKey of 3-propyl-1,2,4-thiadiazol-5-amine?
The InChIKey is FFNJNXAQRQAKMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3S/c1-2-3-4-7-5(6)9-8-4/h2-3H2,1H3,(H2,6,7,8).
What are the key properties of 3-propyl-1,2,4-thiadiazol-5-amine?
3-propyl-1,2,4-thiadiazol-5-amine has a molecular weight of 143.22 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 575489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).