About 1-(3-nitrophenyl)-[1,2,4]triazolo[4,3-a]quinoline
1-(3-nitrophenyl)-[1,2,4]triazolo[4,3-a]quinoline (PubChem CID 575642) has the molecular formula C16H10N4O2
and a molecular weight of 290.28 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-[1,2,4]triazolo[4,3-a]quinoline.
Molecular Properties
| Compound Name | 1-(3-nitrophenyl)-[1,2,4]triazolo[4,3-a]quinoline |
| PubChem CID | 575642 |
| Molecular Formula | C16H10N4O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1-(3-nitrophenyl)-[1,2,4]triazolo[4,3-a]quinoline |
| SMILES | O=[N+]([O-])c1cccc(-c2nnc3ccc4ccccc4n23)c1 |
| InChI | InChI=1S/C16H10N4O2/c21-20(22)13-6-3-5-12(10-13)16-18-17-15-9-8-11-4-1-2-7-14(11)19(15)16/h1-10H |
| InChIKey | BEQYRFSUIRGHST-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-nitrophenyl)-[1,2,4]triazolo[4,3-a]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-nitrophenyl)-[1,2,4]triazolo[4,3-a]quinoline?
The IUPAC name of 1-(3-nitrophenyl)-[1,2,4]triazolo[4,3-a]quinoline (CID 575642) is 1-(3-nitrophenyl)-[1,2,4]triazolo[4,3-a]quinoline.
What is the SMILES notation for 1-(3-nitrophenyl)-[1,2,4]triazolo[4,3-a]quinoline?
The canonical SMILES for 1-(3-nitrophenyl)-[1,2,4]triazolo[4,3-a]quinoline is O=[N+]([O-])c1cccc(-c2nnc3ccc4ccccc4n23)c1.
What is the InChIKey of 1-(3-nitrophenyl)-[1,2,4]triazolo[4,3-a]quinoline?
The InChIKey is BEQYRFSUIRGHST-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N4O2/c21-20(22)13-6-3-5-12(10-13)16-18-17-15-9-8-11-4-1-2-7-14(11)19(15)16/h1-10H.
What are the key properties of 1-(3-nitrophenyl)-[1,2,4]triazolo[4,3-a]quinoline?
1-(3-nitrophenyl)-[1,2,4]triazolo[4,3-a]quinoline has a molecular weight of 290.28 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-nitrophenyl)-[1,2,4]triazolo[4,3-a]quinoline is sourced from PubChem (CID 575642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).