About 4-azidobenzonitrile
4-azidobenzonitrile (PubChem CID 575691) has the molecular formula C7H4N4
and a molecular weight of 144.14 g/mol. Its IUPAC name is 4-azidobenzonitrile.
Molecular Properties
| Compound Name | 4-azidobenzonitrile |
| PubChem CID | 575691 |
| Molecular Formula | C7H4N4 |
| Molecular Weight | 144.14 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 4-azidobenzonitrile |
| SMILES | N#Cc1ccc(N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C7H4N4/c8-5-6-1-3-7(4-2-6)10-11-9/h1-4H |
| InChIKey | YURUKVUJGYBZDU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.14 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azidobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azidobenzonitrile?
The IUPAC name of 4-azidobenzonitrile (CID 575691) is 4-azidobenzonitrile.
What is the SMILES notation for 4-azidobenzonitrile?
The canonical SMILES for 4-azidobenzonitrile is N#Cc1ccc(N=[N+]=[N-])cc1.
What is the InChIKey of 4-azidobenzonitrile?
The InChIKey is YURUKVUJGYBZDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N4/c8-5-6-1-3-7(4-2-6)10-11-9/h1-4H.
What are the key properties of 4-azidobenzonitrile?
4-azidobenzonitrile has a molecular weight of 144.14 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azidobenzonitrile is sourced from PubChem (CID 575691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).