C10H9NOS — CID 575797
5-methylsulfanyl-3-phenyl-1,2-oxazole (PubChem CID 575797) has the molecular formula C10H9NOS and a molecular weight of 191.25 g/mol. Its IUPAC name is 5-methylsulfanyl-3-phenyl-1,2-oxazole.
| Compound Name | 5-methylsulfanyl-3-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 575797 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 5-methylsulfanyl-3-phenyl-1,2-oxazole |
| SMILES | CSc1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C10H9NOS/c1-13-10-7-9(11-12-10)8-5-3-2-4-6-8/h2-7H,1H3 |
| InChIKey | CCUUBLRAMGCOOB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |