About diethyl 1,3-dioxolane-4,5-dicarboxylate
diethyl 1,3-dioxolane-4,5-dicarboxylate (PubChem CID 575846) has the molecular formula C9H14O6
and a molecular weight of 218.20 g/mol. Its IUPAC name is diethyl 1,3-dioxolane-4,5-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 1,3-dioxolane-4,5-dicarboxylate |
| PubChem CID | 575846 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | diethyl 1,3-dioxolane-4,5-dicarboxylate |
| SMILES | CCOC(=O)C1OCOC1C(=O)OCC |
| InChI | InChI=1S/C9H14O6/c1-3-12-8(10)6-7(15-5-14-6)9(11)13-4-2/h6-7H,3-5H2,1-2H3 |
| InChIKey | IAIKNIATGSJSLF-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze diethyl 1,3-dioxolane-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 1,3-dioxolane-4,5-dicarboxylate?
The IUPAC name of diethyl 1,3-dioxolane-4,5-dicarboxylate (CID 575846) is diethyl 1,3-dioxolane-4,5-dicarboxylate.
What is the SMILES notation for diethyl 1,3-dioxolane-4,5-dicarboxylate?
The canonical SMILES for diethyl 1,3-dioxolane-4,5-dicarboxylate is CCOC(=O)C1OCOC1C(=O)OCC.
What is the InChIKey of diethyl 1,3-dioxolane-4,5-dicarboxylate?
The InChIKey is IAIKNIATGSJSLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O6/c1-3-12-8(10)6-7(15-5-14-6)9(11)13-4-2/h6-7H,3-5H2,1-2H3.
What are the key properties of diethyl 1,3-dioxolane-4,5-dicarboxylate?
diethyl 1,3-dioxolane-4,5-dicarboxylate has a molecular weight of 218.20 g/mol, XLogP of -0.15, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 1,3-dioxolane-4,5-dicarboxylate is sourced from PubChem (CID 575846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).