About 2,4-dihydroxy-3,3-dimethyl-N-propan-2-ylbutanamide
2,4-dihydroxy-3,3-dimethyl-N-propan-2-ylbutanamide (PubChem CID 575854) has the molecular formula C9H19NO3
and a molecular weight of 189.25 g/mol. Its IUPAC name is 2,4-dihydroxy-3,3-dimethyl-N-propan-2-ylbutanamide.
Molecular Properties
| Compound Name | 2,4-dihydroxy-3,3-dimethyl-N-propan-2-ylbutanamide |
| PubChem CID | 575854 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | 2,4-dihydroxy-3,3-dimethyl-N-propan-2-ylbutanamide |
| SMILES | CC(C)NC(=O)C(O)C(C)(C)CO |
| InChI | InChI=1S/C9H19NO3/c1-6(2)10-8(13)7(12)9(3,4)5-11/h6-7,11-12H,5H2,1-4H3,(H,10,13) |
| InChIKey | JDWJPSYNCRDJGI-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dihydroxy-3,3-dimethyl-N-propan-2-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dihydroxy-3,3-dimethyl-N-propan-2-ylbutanamide?
The IUPAC name of 2,4-dihydroxy-3,3-dimethyl-N-propan-2-ylbutanamide (CID 575854) is 2,4-dihydroxy-3,3-dimethyl-N-propan-2-ylbutanamide.
What is the SMILES notation for 2,4-dihydroxy-3,3-dimethyl-N-propan-2-ylbutanamide?
The canonical SMILES for 2,4-dihydroxy-3,3-dimethyl-N-propan-2-ylbutanamide is CC(C)NC(=O)C(O)C(C)(C)CO.
What is the InChIKey of 2,4-dihydroxy-3,3-dimethyl-N-propan-2-ylbutanamide?
The InChIKey is JDWJPSYNCRDJGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3/c1-6(2)10-8(13)7(12)9(3,4)5-11/h6-7,11-12H,5H2,1-4H3,(H,10,13).
What are the key properties of 2,4-dihydroxy-3,3-dimethyl-N-propan-2-ylbutanamide?
2,4-dihydroxy-3,3-dimethyl-N-propan-2-ylbutanamide has a molecular weight of 189.25 g/mol, XLogP of -0.11, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydroxy-3,3-dimethyl-N-propan-2-ylbutanamide is sourced from PubChem (CID 575854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).