About 1H-pyrrole-3,4-dicarbonitrile
1H-pyrrole-3,4-dicarbonitrile (PubChem CID 575904) has the molecular formula C6H3N3
and a molecular weight of 117.11 g/mol. Its IUPAC name is 1H-pyrrole-3,4-dicarbonitrile.
Molecular Properties
| Compound Name | 1H-pyrrole-3,4-dicarbonitrile |
| PubChem CID | 575904 |
| Molecular Formula | C6H3N3 |
| Molecular Weight | 117.11 g/mol |
| Exact Mass | 117.03 |
| IUPAC Name | 1H-pyrrole-3,4-dicarbonitrile |
| SMILES | N#Cc1c[nH]cc1C#N |
| InChI | InChI=1S/C6H3N3/c7-1-5-3-9-4-6(5)2-8/h3-4,9H |
| InChIKey | CDMBNXFQNKVZEM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.11 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-pyrrole-3,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrole-3,4-dicarbonitrile?
The IUPAC name of 1H-pyrrole-3,4-dicarbonitrile (CID 575904) is 1H-pyrrole-3,4-dicarbonitrile.
What is the SMILES notation for 1H-pyrrole-3,4-dicarbonitrile?
The canonical SMILES for 1H-pyrrole-3,4-dicarbonitrile is N#Cc1c[nH]cc1C#N.
What is the InChIKey of 1H-pyrrole-3,4-dicarbonitrile?
The InChIKey is CDMBNXFQNKVZEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N3/c7-1-5-3-9-4-6(5)2-8/h3-4,9H.
What are the key properties of 1H-pyrrole-3,4-dicarbonitrile?
1H-pyrrole-3,4-dicarbonitrile has a molecular weight of 117.11 g/mol, XLogP of 0.76, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrole-3,4-dicarbonitrile is sourced from PubChem (CID 575904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).