About (4-aminophenyl) selenocyanate
(4-aminophenyl) selenocyanate (PubChem CID 575906) has the molecular formula C7H6N2Se
and a molecular weight of 197.10 g/mol. Its IUPAC name is (4-aminophenyl) selenocyanate.
Molecular Properties
| Compound Name | (4-aminophenyl) selenocyanate |
| PubChem CID | 575906 |
| Molecular Formula | C7H6N2Se |
| Molecular Weight | 197.10 g/mol |
| Exact Mass | 197.97 |
| IUPAC Name | (4-aminophenyl) selenocyanate |
| SMILES | N#C[Se]c1ccc(N)cc1 |
| InChI | InChI=1S/C7H6N2Se/c8-5-10-7-3-1-6(9)2-4-7/h1-4H,9H2 |
| InChIKey | UMRQUSGJQJGLNV-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.10 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl) selenocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl) selenocyanate?
The IUPAC name of (4-aminophenyl) selenocyanate (CID 575906) is (4-aminophenyl) selenocyanate.
What is the SMILES notation for (4-aminophenyl) selenocyanate?
The canonical SMILES for (4-aminophenyl) selenocyanate is N#C[Se]c1ccc(N)cc1.
What is the InChIKey of (4-aminophenyl) selenocyanate?
The InChIKey is UMRQUSGJQJGLNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2Se/c8-5-10-7-3-1-6(9)2-4-7/h1-4H,9H2.
What are the key properties of (4-aminophenyl) selenocyanate?
(4-aminophenyl) selenocyanate has a molecular weight of 197.10 g/mol, XLogP of 0.08, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl) selenocyanate is sourced from PubChem (CID 575906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).