About trimethylsilyl 2-oxooctanoate
trimethylsilyl 2-oxooctanoate (PubChem CID 575967) has the molecular formula C11H22O3Si
and a molecular weight of 230.38 g/mol. Its IUPAC name is trimethylsilyl 2-oxooctanoate.
Molecular Properties
| Compound Name | trimethylsilyl 2-oxooctanoate |
| PubChem CID | 575967 |
| Molecular Formula | C11H22O3Si |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | trimethylsilyl 2-oxooctanoate |
| SMILES | CCCCCCC(=O)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C11H22O3Si/c1-5-6-7-8-9-10(12)11(13)14-15(2,3)4/h5-9H2,1-4H3 |
| InChIKey | QFYWLKHRYDIOSX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl 2-oxooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl 2-oxooctanoate?
The IUPAC name of trimethylsilyl 2-oxooctanoate (CID 575967) is trimethylsilyl 2-oxooctanoate.
What is the SMILES notation for trimethylsilyl 2-oxooctanoate?
The canonical SMILES for trimethylsilyl 2-oxooctanoate is CCCCCCC(=O)C(=O)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl 2-oxooctanoate?
The InChIKey is QFYWLKHRYDIOSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3Si/c1-5-6-7-8-9-10(12)11(13)14-15(2,3)4/h5-9H2,1-4H3.
What are the key properties of trimethylsilyl 2-oxooctanoate?
trimethylsilyl 2-oxooctanoate has a molecular weight of 230.38 g/mol, XLogP of 2.90, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl 2-oxooctanoate is sourced from PubChem (CID 575967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).