C6H5Cl — CID 575975
1-chloro-2,3,4,5,6-pentadeuteriobenzene (PubChem CID 575975) has the molecular formula C6H5Cl and a molecular weight of 117.59 g/mol. Its IUPAC name is 1-chloro-2,3,4,5,6-pentadeuteriobenzene.
| Compound Name | 1-chloro-2,3,4,5,6-pentadeuteriobenzene |
|---|---|
| PubChem CID | 575975 |
| Molecular Formula | C6H5Cl |
| Molecular Weight | 117.59 g/mol |
| Exact Mass | 117.04 |
| IUPAC Name | 1-chloro-2,3,4,5,6-pentadeuteriobenzene |
| SMILES | [2H]c1c([2H])c([2H])c(Cl)c([2H])c1[2H] |
| InChI | InChI=1S/C6H5Cl/c7-6-4-2-1-3-5-6/h1-5H/i1D,2D,3D,4D,5D |
| InChIKey | MVPPADPHJFYWMZ-RALIUCGRSA-N |
| XLogP | 2.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.59 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |