C10H12O2 — CID 575976
pentacyclo[5.3.0.02,5.03,9.04,8]decane-6,10-diol (PubChem CID 575976) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is pentacyclo[5.3.0.02,5.03,9.04,8]decane-6,10-diol.
| Compound Name | pentacyclo[5.3.0.02,5.03,9.04,8]decane-6,10-diol |
|---|---|
| PubChem CID | 575976 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | pentacyclo[5.3.0.02,5.03,9.04,8]decane-6,10-diol |
| SMILES | OC1C2C3C(O)C4C2C2C1C3C42 |
| InChI | InChI=1S/C10H12O2/c11-9-5-1-2-4(5)8-7(9)3(1)6(2)10(8)12/h1-12H |
| InChIKey | XPRBZRUGYHJOGG-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |