C15H12F4O3 — CID 576011
2'-(2,2,3,3-tetrafluorocyclobutyl)spiro[4-oxatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione (PubChem CID 576011) has the molecular formula C15H12F4O3 and a molecular weight of 316.25 g/mol. Its IUPAC name is 2'-(2,2,3,3-tetrafluorocyclobutyl)spiro[4-oxatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione.
| Compound Name | 2'-(2,2,3,3-tetrafluorocyclobutyl)spiro[4-oxatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione |
|---|---|
| PubChem CID | 576011 |
| Molecular Formula | C15H12F4O3 |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2'-(2,2,3,3-tetrafluorocyclobutyl)spiro[4-oxatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione |
| SMILES | O=C1OC(=O)C2C1C1C=CC2C12CC2C1CC(F)(F)C1(F)F |
| InChI | InChI=1S/C15H12F4O3/c16-14(17)4-8(15(14,18)19)7-3-13(7)5-1-2-6(13)10-9(5)11(20)22-12(10)21/h1-2,5-10H,3-4H2 |
| InChIKey | WILPAPVUDZVAGG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|