About 3-methylidenetricyclo[3.2.1.02,4]oct-6-ene
3-methylidenetricyclo[3.2.1.02,4]oct-6-ene (PubChem CID 576037) has the molecular formula C9H10
and a molecular weight of 118.18 g/mol. Its IUPAC name is 3-methylidenetricyclo[3.2.1.02,4]oct-6-ene.
Molecular Properties
| Compound Name | 3-methylidenetricyclo[3.2.1.02,4]oct-6-ene |
| PubChem CID | 576037 |
| Molecular Formula | C9H10 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | 3-methylidenetricyclo[3.2.1.02,4]oct-6-ene |
| SMILES | C=C1C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C9H10/c1-5-8-6-2-3-7(4-6)9(5)8/h2-3,6-9H,1,4H2 |
| InChIKey | SILIFYUSYIFKDQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylidenetricyclo[3.2.1.02,4]oct-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylidenetricyclo[3.2.1.02,4]oct-6-ene?
The IUPAC name of 3-methylidenetricyclo[3.2.1.02,4]oct-6-ene (CID 576037) is 3-methylidenetricyclo[3.2.1.02,4]oct-6-ene.
What is the SMILES notation for 3-methylidenetricyclo[3.2.1.02,4]oct-6-ene?
The canonical SMILES for 3-methylidenetricyclo[3.2.1.02,4]oct-6-ene is C=C1C2C3C=CC(C3)C12.
What is the InChIKey of 3-methylidenetricyclo[3.2.1.02,4]oct-6-ene?
The InChIKey is SILIFYUSYIFKDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10/c1-5-8-6-2-3-7(4-6)9(5)8/h2-3,6-9H,1,4H2.
What are the key properties of 3-methylidenetricyclo[3.2.1.02,4]oct-6-ene?
3-methylidenetricyclo[3.2.1.02,4]oct-6-ene has a molecular weight of 118.18 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylidenetricyclo[3.2.1.02,4]oct-6-ene is sourced from PubChem (CID 576037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).