C14H16 — CID 576086
hexacyclo[9.2.1.02,10.03,8.04,6.05,9]tetradec-12-ene (PubChem CID 576086) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is hexacyclo[9.2.1.02,10.03,8.04,6.05,9]tetradec-12-ene.
| Compound Name | hexacyclo[9.2.1.02,10.03,8.04,6.05,9]tetradec-12-ene |
|---|---|
| PubChem CID | 576086 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | hexacyclo[9.2.1.02,10.03,8.04,6.05,9]tetradec-12-ene |
| SMILES | C1=CC2CC1C1C2C2C3CC4C(C31)C42 |
| InChI | InChI=1S/C14H16/c1-2-6-3-5(1)9-10(6)12-7-4-8-13(11(7)9)14(8)12/h1-2,5-14H,3-4H2 |
| InChIKey | IGKDVUVITBCBRG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|