About (4-acetyloxy-2,3,5-trimethoxypentyl) acetate
(4-acetyloxy-2,3,5-trimethoxypentyl) acetate (PubChem CID 576116) has the molecular formula C12H22O7
and a molecular weight of 278.30 g/mol. Its IUPAC name is (4-acetyloxy-2,3,5-trimethoxypentyl) acetate.
Molecular Properties
| Compound Name | (4-acetyloxy-2,3,5-trimethoxypentyl) acetate |
| PubChem CID | 576116 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (4-acetyloxy-2,3,5-trimethoxypentyl) acetate |
| SMILES | COCC(OC(C)=O)C(OC)C(COC(C)=O)OC |
| InChI | InChI=1S/C12H22O7/c1-8(13)18-7-10(16-4)12(17-5)11(6-15-3)19-9(2)14/h10-12H,6-7H2,1-5H3 |
| InChIKey | YHSLPTQQWRWXKO-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (4-acetyloxy-2,3,5-trimethoxypentyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetyloxy-2,3,5-trimethoxypentyl) acetate?
The IUPAC name of (4-acetyloxy-2,3,5-trimethoxypentyl) acetate (CID 576116) is (4-acetyloxy-2,3,5-trimethoxypentyl) acetate.
What is the SMILES notation for (4-acetyloxy-2,3,5-trimethoxypentyl) acetate?
The canonical SMILES for (4-acetyloxy-2,3,5-trimethoxypentyl) acetate is COCC(OC(C)=O)C(OC)C(COC(C)=O)OC.
What is the InChIKey of (4-acetyloxy-2,3,5-trimethoxypentyl) acetate?
The InChIKey is YHSLPTQQWRWXKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O7/c1-8(13)18-7-10(16-4)12(17-5)11(6-15-3)19-9(2)14/h10-12H,6-7H2,1-5H3.
What are the key properties of (4-acetyloxy-2,3,5-trimethoxypentyl) acetate?
(4-acetyloxy-2,3,5-trimethoxypentyl) acetate has a molecular weight of 278.30 g/mol, XLogP of 0.16, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetyloxy-2,3,5-trimethoxypentyl) acetate is sourced from PubChem (CID 576116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).