About 2-hydroxy-2,3-dihydroindole-1-carbaldehyde
2-hydroxy-2,3-dihydroindole-1-carbaldehyde (PubChem CID 576131) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-hydroxy-2,3-dihydroindole-1-carbaldehyde.
Molecular Properties
| Compound Name | 2-hydroxy-2,3-dihydroindole-1-carbaldehyde |
| PubChem CID | 576131 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 2-hydroxy-2,3-dihydroindole-1-carbaldehyde |
| SMILES | O=CN1c2ccccc2CC1O |
| InChI | InChI=1S/C9H9NO2/c11-6-10-8-4-2-1-3-7(8)5-9(10)12/h1-4,6,9,12H,5H2 |
| InChIKey | BROIJIZBCLZVNK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2,3-dihydroindole-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2,3-dihydroindole-1-carbaldehyde?
The IUPAC name of 2-hydroxy-2,3-dihydroindole-1-carbaldehyde (CID 576131) is 2-hydroxy-2,3-dihydroindole-1-carbaldehyde.
What is the SMILES notation for 2-hydroxy-2,3-dihydroindole-1-carbaldehyde?
The canonical SMILES for 2-hydroxy-2,3-dihydroindole-1-carbaldehyde is O=CN1c2ccccc2CC1O.
What is the InChIKey of 2-hydroxy-2,3-dihydroindole-1-carbaldehyde?
The InChIKey is BROIJIZBCLZVNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c11-6-10-8-4-2-1-3-7(8)5-9(10)12/h1-4,6,9,12H,5H2.
What are the key properties of 2-hydroxy-2,3-dihydroindole-1-carbaldehyde?
2-hydroxy-2,3-dihydroindole-1-carbaldehyde has a molecular weight of 163.18 g/mol, XLogP of 0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2,3-dihydroindole-1-carbaldehyde is sourced from PubChem (CID 576131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).