C11H14N2 — CID 576157
2-phenyl-4,5,6,7-tetrahydro-1H-1,3-diazepine (PubChem CID 576157) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 2-phenyl-4,5,6,7-tetrahydro-1H-1,3-diazepine.
| Compound Name | 2-phenyl-4,5,6,7-tetrahydro-1H-1,3-diazepine |
|---|---|
| PubChem CID | 576157 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2-phenyl-4,5,6,7-tetrahydro-1H-1,3-diazepine |
| SMILES | c1ccc(C2=NCCCCN2)cc1 |
| InChI | InChI=1S/C11H14N2/c1-2-6-10(7-3-1)11-12-8-4-5-9-13-11/h1-3,6-7H,4-5,8-9H2,(H,12,13) |
| InChIKey | YPSSKZYWAMIXNE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |