C5H3F5N2 — CID 576170
2-(1,1,2,2,2-pentafluoroethyl)-1H-imidazole (PubChem CID 576170) has the molecular formula C5H3F5N2 and a molecular weight of 186.08 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethyl)-1H-imidazole.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethyl)-1H-imidazole |
|---|---|
| PubChem CID | 576170 |
| Molecular Formula | C5H3F5N2 |
| Molecular Weight | 186.08 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethyl)-1H-imidazole |
| SMILES | FC(F)(F)C(F)(F)c1ncc[nH]1 |
| InChI | InChI=1S/C5H3F5N2/c6-4(7,5(8,9)10)3-11-1-2-12-3/h1-2H,(H,11,12) |
| InChIKey | NMXYOLNEJXKAJQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.08 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|