C26H30N2O2 — CID 576206
2-[1-[2-(methoxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]ethyl]-4,5-diphenyl-1,3-oxazole (PubChem CID 576206) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-[1-[2-(methoxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]ethyl]-4,5-diphenyl-1,3-oxazole.
| Compound Name | 2-[1-[2-(methoxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]ethyl]-4,5-diphenyl-1,3-oxazole |
|---|---|
| PubChem CID | 576206 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 2-[1-[2-(methoxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]ethyl]-4,5-diphenyl-1,3-oxazole |
| SMILES | COCC1CC2CCCC2N1C(C)c1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C26H30N2O2/c1-18(28-22(17-29-2)16-21-14-9-15-23(21)28)26-27-24(19-10-5-3-6-11-19)25(30-26)20-12-7-4-8-13-20/h3-8,10-13,18,21-23H,9,14-17H2,1-2H3 |
| InChIKey | RYIFACOHNLKJAF-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |