About 2,4-bis(4-methylphenyl)-6-phenyl-1,3,5-triazine
2,4-bis(4-methylphenyl)-6-phenyl-1,3,5-triazine (PubChem CID 576224) has the molecular formula C23H19N3
and a molecular weight of 337.43 g/mol. Its IUPAC name is 2,4-bis(4-methylphenyl)-6-phenyl-1,3,5-triazine.
Molecular Properties
| Compound Name | 2,4-bis(4-methylphenyl)-6-phenyl-1,3,5-triazine |
| PubChem CID | 576224 |
| Molecular Formula | C23H19N3 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2,4-bis(4-methylphenyl)-6-phenyl-1,3,5-triazine |
| SMILES | Cc1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C23H19N3/c1-16-8-12-19(13-9-16)22-24-21(18-6-4-3-5-7-18)25-23(26-22)20-14-10-17(2)11-15-20/h3-15H,1-2H3 |
| InChIKey | TTZLSDJJPLRJHY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-bis(4-methylphenyl)-6-phenyl-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(4-methylphenyl)-6-phenyl-1,3,5-triazine?
The IUPAC name of 2,4-bis(4-methylphenyl)-6-phenyl-1,3,5-triazine (CID 576224) is 2,4-bis(4-methylphenyl)-6-phenyl-1,3,5-triazine.
What is the SMILES notation for 2,4-bis(4-methylphenyl)-6-phenyl-1,3,5-triazine?
The canonical SMILES for 2,4-bis(4-methylphenyl)-6-phenyl-1,3,5-triazine is Cc1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(C)cc3)n2)cc1.
What is the InChIKey of 2,4-bis(4-methylphenyl)-6-phenyl-1,3,5-triazine?
The InChIKey is TTZLSDJJPLRJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N3/c1-16-8-12-19(13-9-16)22-24-21(18-6-4-3-5-7-18)25-23(26-22)20-14-10-17(2)11-15-20/h3-15H,1-2H3.
What are the key properties of 2,4-bis(4-methylphenyl)-6-phenyl-1,3,5-triazine?
2,4-bis(4-methylphenyl)-6-phenyl-1,3,5-triazine has a molecular weight of 337.43 g/mol, XLogP of 5.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(4-methylphenyl)-6-phenyl-1,3,5-triazine is sourced from PubChem (CID 576224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).