About 3-phenylthiane
3-phenylthiane (PubChem CID 576343) has the molecular formula C11H14S
and a molecular weight of 178.30 g/mol. Its IUPAC name is 3-phenylthiane.
Molecular Properties
| Compound Name | 3-phenylthiane |
| PubChem CID | 576343 |
| Molecular Formula | C11H14S |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 3-phenylthiane |
| SMILES | c1ccc(C2CCCSC2)cc1 |
| InChI | InChI=1S/C11H14S/c1-2-5-10(6-3-1)11-7-4-8-12-9-11/h1-3,5-6,11H,4,7-9H2 |
| InChIKey | ISEXWPHXDCRQBE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-phenylthiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylthiane?
The IUPAC name of 3-phenylthiane (CID 576343) is 3-phenylthiane.
What is the SMILES notation for 3-phenylthiane?
The canonical SMILES for 3-phenylthiane is c1ccc(C2CCCSC2)cc1.
What is the InChIKey of 3-phenylthiane?
The InChIKey is ISEXWPHXDCRQBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14S/c1-2-5-10(6-3-1)11-7-4-8-12-9-11/h1-3,5-6,11H,4,7-9H2.
What are the key properties of 3-phenylthiane?
3-phenylthiane has a molecular weight of 178.30 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylthiane is sourced from PubChem (CID 576343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).