About (2-ethoxy-2-oxoethyl) 2-phenylacetate
(2-ethoxy-2-oxoethyl) 2-phenylacetate (PubChem CID 576346) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) 2-phenylacetate.
Molecular Properties
| Compound Name | (2-ethoxy-2-oxoethyl) 2-phenylacetate |
| PubChem CID | 576346 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (2-ethoxy-2-oxoethyl) 2-phenylacetate |
| SMILES | CCOC(=O)COC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H14O4/c1-2-15-12(14)9-16-11(13)8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| InChIKey | UJHKDJROFCQOBO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-ethoxy-2-oxoethyl) 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxy-2-oxoethyl) 2-phenylacetate?
The IUPAC name of (2-ethoxy-2-oxoethyl) 2-phenylacetate (CID 576346) is (2-ethoxy-2-oxoethyl) 2-phenylacetate.
What is the SMILES notation for (2-ethoxy-2-oxoethyl) 2-phenylacetate?
The canonical SMILES for (2-ethoxy-2-oxoethyl) 2-phenylacetate is CCOC(=O)COC(=O)Cc1ccccc1.
What is the InChIKey of (2-ethoxy-2-oxoethyl) 2-phenylacetate?
The InChIKey is UJHKDJROFCQOBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-2-15-12(14)9-16-11(13)8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3.
What are the key properties of (2-ethoxy-2-oxoethyl) 2-phenylacetate?
(2-ethoxy-2-oxoethyl) 2-phenylacetate has a molecular weight of 222.24 g/mol, XLogP of 1.34, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxy-2-oxoethyl) 2-phenylacetate is sourced from PubChem (CID 576346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).