About 2,5-diphenyloxolane
2,5-diphenyloxolane (PubChem CID 576417) has the molecular formula C16H16O
and a molecular weight of 224.30 g/mol. Its IUPAC name is 2,5-diphenyloxolane.
Molecular Properties
| Compound Name | 2,5-diphenyloxolane |
| PubChem CID | 576417 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2,5-diphenyloxolane |
| SMILES | c1ccc(C2CCC(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C16H16O/c1-3-7-13(8-4-1)15-11-12-16(17-15)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
| InChIKey | ZKTQNVXLUVNDFA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-diphenyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diphenyloxolane?
The IUPAC name of 2,5-diphenyloxolane (CID 576417) is 2,5-diphenyloxolane.
What is the SMILES notation for 2,5-diphenyloxolane?
The canonical SMILES for 2,5-diphenyloxolane is c1ccc(C2CCC(c3ccccc3)O2)cc1.
What is the InChIKey of 2,5-diphenyloxolane?
The InChIKey is ZKTQNVXLUVNDFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O/c1-3-7-13(8-4-1)15-11-12-16(17-15)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2.
What are the key properties of 2,5-diphenyloxolane?
2,5-diphenyloxolane has a molecular weight of 224.30 g/mol, XLogP of 4.28, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diphenyloxolane is sourced from PubChem (CID 576417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).