About isoquinoline-5,8-dione
isoquinoline-5,8-dione (PubChem CID 5766) has the molecular formula C9H5NO2
and a molecular weight of 159.14 g/mol. Its IUPAC name is isoquinoline-5,8-dione.
Molecular Properties
| Compound Name | isoquinoline-5,8-dione |
| PubChem CID | 5766 |
| Molecular Formula | C9H5NO2 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.03 |
| IUPAC Name | isoquinoline-5,8-dione |
| SMILES | O=C1C=CC(=O)c2cnccc21 |
| InChI | InChI=1S/C9H5NO2/c11-8-1-2-9(12)7-5-10-4-3-6(7)8/h1-5H |
| InChIKey | CUPFSRUOCULQSY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze isoquinoline-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinoline-5,8-dione?
The IUPAC name of isoquinoline-5,8-dione (CID 5766) is isoquinoline-5,8-dione.
What is the SMILES notation for isoquinoline-5,8-dione?
The canonical SMILES for isoquinoline-5,8-dione is O=C1C=CC(=O)c2cnccc21.
What is the InChIKey of isoquinoline-5,8-dione?
The InChIKey is CUPFSRUOCULQSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO2/c11-8-1-2-9(12)7-5-10-4-3-6(7)8/h1-5H.
What are the key properties of isoquinoline-5,8-dione?
isoquinoline-5,8-dione has a molecular weight of 159.14 g/mol, XLogP of 1.02, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinoline-5,8-dione is sourced from PubChem (CID 5766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).