C14H8F19NO6 — CID 576665
2,3,3,3-tetrafluoro-1-morpholin-4-yl-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]propan-1-one (PubChem CID 576665) has the molecular formula C14H8F19NO6 and a molecular weight of 647.18 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-1-morpholin-4-yl-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]propan-1-one.
| Compound Name | 2,3,3,3-tetrafluoro-1-morpholin-4-yl-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]propan-1-one |
|---|---|
| PubChem CID | 576665 |
| Molecular Formula | C14H8F19NO6 |
| Molecular Weight | 647.18 g/mol |
| Exact Mass | 647.00 |
| IUPAC Name | 2,3,3,3-tetrafluoro-1-morpholin-4-yl-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]propan-1-one |
| SMILES | O=C(N1CCOCC1)C(F)(OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H8F19NO6/c15-6(7(16,17)18,5(35)34-1-3-36-4-2-34)37-8(19,20)9(21,22)38-10(23,24)11(25,26)39-12(27,28)13(29,30)40-14(31,32)33/h1-4H2 |
| InChIKey | FXYXMEZXHAMBGJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.18 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|