About N-phenylcarbamoyl chloride
N-phenylcarbamoyl chloride (PubChem CID 576741) has the molecular formula C7H6ClNO
and a molecular weight of 155.58 g/mol. Its IUPAC name is N-phenylcarbamoyl chloride.
Molecular Properties
| Compound Name | N-phenylcarbamoyl chloride |
| PubChem CID | 576741 |
| Molecular Formula | C7H6ClNO |
| Molecular Weight | 155.58 g/mol |
| Exact Mass | 155.01 |
| IUPAC Name | N-phenylcarbamoyl chloride |
| SMILES | O=C(Cl)Nc1ccccc1 |
| InChI | InChI=1S/C7H6ClNO/c8-7(10)9-6-4-2-1-3-5-6/h1-5H,(H,9,10) |
| InChIKey | YSBUANSGDLZTKV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.58 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-phenylcarbamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylcarbamoyl chloride?
The IUPAC name of N-phenylcarbamoyl chloride (CID 576741) is N-phenylcarbamoyl chloride.
What is the SMILES notation for N-phenylcarbamoyl chloride?
The canonical SMILES for N-phenylcarbamoyl chloride is O=C(Cl)Nc1ccccc1.
What is the InChIKey of N-phenylcarbamoyl chloride?
The InChIKey is YSBUANSGDLZTKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNO/c8-7(10)9-6-4-2-1-3-5-6/h1-5H,(H,9,10).
What are the key properties of N-phenylcarbamoyl chloride?
N-phenylcarbamoyl chloride has a molecular weight of 155.58 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylcarbamoyl chloride is sourced from PubChem (CID 576741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).