About 1,4-bis(4-methylphenyl)piperazine-2,5-dione
1,4-bis(4-methylphenyl)piperazine-2,5-dione (PubChem CID 576878) has the molecular formula C18H18N2O2
and a molecular weight of 294.35 g/mol. Its IUPAC name is 1,4-bis(4-methylphenyl)piperazine-2,5-dione.
Molecular Properties
| Compound Name | 1,4-bis(4-methylphenyl)piperazine-2,5-dione |
| PubChem CID | 576878 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1,4-bis(4-methylphenyl)piperazine-2,5-dione |
| SMILES | Cc1ccc(N2CC(=O)N(c3ccc(C)cc3)CC2=O)cc1 |
| InChI | InChI=1S/C18H18N2O2/c1-13-3-7-15(8-4-13)19-11-18(22)20(12-17(19)21)16-9-5-14(2)6-10-16/h3-10H,11-12H2,1-2H3 |
| InChIKey | MSDGXGKXTBIVPD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-bis(4-methylphenyl)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(4-methylphenyl)piperazine-2,5-dione?
The IUPAC name of 1,4-bis(4-methylphenyl)piperazine-2,5-dione (CID 576878) is 1,4-bis(4-methylphenyl)piperazine-2,5-dione.
What is the SMILES notation for 1,4-bis(4-methylphenyl)piperazine-2,5-dione?
The canonical SMILES for 1,4-bis(4-methylphenyl)piperazine-2,5-dione is Cc1ccc(N2CC(=O)N(c3ccc(C)cc3)CC2=O)cc1.
What is the InChIKey of 1,4-bis(4-methylphenyl)piperazine-2,5-dione?
The InChIKey is MSDGXGKXTBIVPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O2/c1-13-3-7-15(8-4-13)19-11-18(22)20(12-17(19)21)16-9-5-14(2)6-10-16/h3-10H,11-12H2,1-2H3.
What are the key properties of 1,4-bis(4-methylphenyl)piperazine-2,5-dione?
1,4-bis(4-methylphenyl)piperazine-2,5-dione has a molecular weight of 294.35 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(4-methylphenyl)piperazine-2,5-dione is sourced from PubChem (CID 576878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).