C17H20O4 — CID 576889
3,3,5,5-tetramethyl-6-(4-methylbenzoyl)oxane-2,4-dione (PubChem CID 576889) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-6-(4-methylbenzoyl)oxane-2,4-dione.
| Compound Name | 3,3,5,5-tetramethyl-6-(4-methylbenzoyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 576889 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3,3,5,5-tetramethyl-6-(4-methylbenzoyl)oxane-2,4-dione |
| SMILES | Cc1ccc(C(=O)C2OC(=O)C(C)(C)C(=O)C2(C)C)cc1 |
| InChI | InChI=1S/C17H20O4/c1-10-6-8-11(9-7-10)12(18)13-16(2,3)14(19)17(4,5)15(20)21-13/h6-9,13H,1-5H3 |
| InChIKey | LSJZKOMWWTUNDL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|