About CID 57693377
CID 57693377 (PubChem CID 57693377) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol.
Molecular Properties
| Compound Name | CID 57693377 |
| PubChem CID | 57693377 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | — |
| SMILES | C=C1[C@@H](O[C@@H]([C@@H]1O)CO)[CH] |
| InChI | InChI=1S/C7H10O3/c1-4-5(2)10-6(3-8)7(4)9/h2,5-9H,1,3H2/t5-,6+,7+/m0/s1 |
| InChIKey | HHKKTWANYGRTDC-RRKCRQDMSA-N |
| XLogP | -0.40 |
| TPSA | 49.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 144 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 57693377 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57693377?
The IUPAC name of CID 57693377 (CID 57693377) is not available.
What is the SMILES notation for CID 57693377?
The canonical SMILES for CID 57693377 is C=C1[C@@H](O[C@@H]([C@@H]1O)CO)[CH].
What is the InChIKey of CID 57693377?
The InChIKey is HHKKTWANYGRTDC-RRKCRQDMSA-N. The full InChI is InChI=1S/C7H10O3/c1-4-5(2)10-6(3-8)7(4)9/h2,5-9H,1,3H2/t5-,6+,7+/m0/s1.
What are the key properties of CID 57693377?
CID 57693377 has a molecular weight of 142.15 g/mol, XLogP of -0.40, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57693377 is sourced from PubChem (CID 57693377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).