About imidazo[1,2-a]pyrimidine
imidazo[1,2-a]pyrimidine (PubChem CID 577018) has the molecular formula C6H5N3
and a molecular weight of 119.13 g/mol. Its IUPAC name is imidazo[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | imidazo[1,2-a]pyrimidine |
| PubChem CID | 577018 |
| Molecular Formula | C6H5N3 |
| Molecular Weight | 119.13 g/mol |
| Exact Mass | 119.05 |
| IUPAC Name | imidazo[1,2-a]pyrimidine |
| SMILES | c1cnc2nccn2c1 |
| InChI | InChI=1S/C6H5N3/c1-2-7-6-8-3-5-9(6)4-1/h1-5H |
| InChIKey | INSWZAQOISIYDT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.13 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze imidazo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-a]pyrimidine?
The IUPAC name of imidazo[1,2-a]pyrimidine (CID 577018) is imidazo[1,2-a]pyrimidine.
What is the SMILES notation for imidazo[1,2-a]pyrimidine?
The canonical SMILES for imidazo[1,2-a]pyrimidine is c1cnc2nccn2c1.
What is the InChIKey of imidazo[1,2-a]pyrimidine?
The InChIKey is INSWZAQOISIYDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3/c1-2-7-6-8-3-5-9(6)4-1/h1-5H.
What are the key properties of imidazo[1,2-a]pyrimidine?
imidazo[1,2-a]pyrimidine has a molecular weight of 119.13 g/mol, XLogP of 0.73, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-a]pyrimidine is sourced from PubChem (CID 577018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).