About 5H-pyrrolo[3,2-d]pyrimidine
5H-pyrrolo[3,2-d]pyrimidine (PubChem CID 577022) has the molecular formula C6H5N3
and a molecular weight of 119.13 g/mol. Its IUPAC name is 5H-pyrrolo[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 5H-pyrrolo[3,2-d]pyrimidine |
| PubChem CID | 577022 |
| Molecular Formula | C6H5N3 |
| Molecular Weight | 119.13 g/mol |
| Exact Mass | 119.05 |
| IUPAC Name | 5H-pyrrolo[3,2-d]pyrimidine |
| SMILES | c1ncc2[nH]ccc2n1 |
| InChI | InChI=1S/C6H5N3/c1-2-8-6-3-7-4-9-5(1)6/h1-4,8H |
| InChIKey | KDOPAZIWBAHVJB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.13 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5H-pyrrolo[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrrolo[3,2-d]pyrimidine?
The IUPAC name of 5H-pyrrolo[3,2-d]pyrimidine (CID 577022) is 5H-pyrrolo[3,2-d]pyrimidine.
What is the SMILES notation for 5H-pyrrolo[3,2-d]pyrimidine?
The canonical SMILES for 5H-pyrrolo[3,2-d]pyrimidine is c1ncc2[nH]ccc2n1.
What is the InChIKey of 5H-pyrrolo[3,2-d]pyrimidine?
The InChIKey is KDOPAZIWBAHVJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3/c1-2-8-6-3-7-4-9-5(1)6/h1-4,8H.
What are the key properties of 5H-pyrrolo[3,2-d]pyrimidine?
5H-pyrrolo[3,2-d]pyrimidine has a molecular weight of 119.13 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrrolo[3,2-d]pyrimidine is sourced from PubChem (CID 577022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).