About 3,5-diphenyl-1,4,2-dioxazole
3,5-diphenyl-1,4,2-dioxazole (PubChem CID 577063) has the molecular formula C14H11NO2
and a molecular weight of 225.25 g/mol. Its IUPAC name is 3,5-diphenyl-1,4,2-dioxazole.
Molecular Properties
| Compound Name | 3,5-diphenyl-1,4,2-dioxazole |
| PubChem CID | 577063 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 3,5-diphenyl-1,4,2-dioxazole |
| SMILES | c1ccc(C2=NOC(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C14H11NO2/c1-3-7-11(8-4-1)13-15-17-14(16-13)12-9-5-2-6-10-12/h1-10,14H |
| InChIKey | NSICGLKWGMZESG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-diphenyl-1,4,2-dioxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diphenyl-1,4,2-dioxazole?
The IUPAC name of 3,5-diphenyl-1,4,2-dioxazole (CID 577063) is 3,5-diphenyl-1,4,2-dioxazole.
What is the SMILES notation for 3,5-diphenyl-1,4,2-dioxazole?
The canonical SMILES for 3,5-diphenyl-1,4,2-dioxazole is c1ccc(C2=NOC(c3ccccc3)O2)cc1.
What is the InChIKey of 3,5-diphenyl-1,4,2-dioxazole?
The InChIKey is NSICGLKWGMZESG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2/c1-3-7-11(8-4-1)13-15-17-14(16-13)12-9-5-2-6-10-12/h1-10,14H.
What are the key properties of 3,5-diphenyl-1,4,2-dioxazole?
3,5-diphenyl-1,4,2-dioxazole has a molecular weight of 225.25 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diphenyl-1,4,2-dioxazole is sourced from PubChem (CID 577063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).