About 2-(4,4-dimethylcyclohex-2-en-1-yl)-1,3-dithian-2-ol
2-(4,4-dimethylcyclohex-2-en-1-yl)-1,3-dithian-2-ol (PubChem CID 577135) has the molecular formula C12H20OS2
and a molecular weight of 244.42 g/mol. Its IUPAC name is 2-(4,4-dimethylcyclohex-2-en-1-yl)-1,3-dithian-2-ol.
Molecular Properties
| Compound Name | 2-(4,4-dimethylcyclohex-2-en-1-yl)-1,3-dithian-2-ol |
| PubChem CID | 577135 |
| Molecular Formula | C12H20OS2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-(4,4-dimethylcyclohex-2-en-1-yl)-1,3-dithian-2-ol |
| SMILES | CC1(C)C=CC(C2(O)SCCCS2)CC1 |
| InChI | InChI=1S/C12H20OS2/c1-11(2)6-4-10(5-7-11)12(13)14-8-3-9-15-12/h4,6,10,13H,3,5,7-9H2,1-2H3 |
| InChIKey | SFQRJJYEHCUNRF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-dimethylcyclohex-2-en-1-yl)-1,3-dithian-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethylcyclohex-2-en-1-yl)-1,3-dithian-2-ol?
The IUPAC name of 2-(4,4-dimethylcyclohex-2-en-1-yl)-1,3-dithian-2-ol (CID 577135) is 2-(4,4-dimethylcyclohex-2-en-1-yl)-1,3-dithian-2-ol.
What is the SMILES notation for 2-(4,4-dimethylcyclohex-2-en-1-yl)-1,3-dithian-2-ol?
The canonical SMILES for 2-(4,4-dimethylcyclohex-2-en-1-yl)-1,3-dithian-2-ol is CC1(C)C=CC(C2(O)SCCCS2)CC1.
What is the InChIKey of 2-(4,4-dimethylcyclohex-2-en-1-yl)-1,3-dithian-2-ol?
The InChIKey is SFQRJJYEHCUNRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20OS2/c1-11(2)6-4-10(5-7-11)12(13)14-8-3-9-15-12/h4,6,10,13H,3,5,7-9H2,1-2H3.
What are the key properties of 2-(4,4-dimethylcyclohex-2-en-1-yl)-1,3-dithian-2-ol?
2-(4,4-dimethylcyclohex-2-en-1-yl)-1,3-dithian-2-ol has a molecular weight of 244.42 g/mol, XLogP of 3.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethylcyclohex-2-en-1-yl)-1,3-dithian-2-ol is sourced from PubChem (CID 577135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).